About (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine
(4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine (PubChem CID 105170368) has the molecular formula C15H25F2NO2
and a molecular weight of 289.37 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine |
| PubChem CID | 105170368 |
| Molecular Formula | C15H25F2NO2 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine |
| SMILES | NC(C1CCC(F)(F)CC1)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C15H25F2NO2/c16-15(17)4-1-11(2-5-15)13(18)12-3-7-20-14(9-12)6-8-19-10-14/h11-13H,1-10,18H2 |
| InChIKey | DFGWFRWRYMXGHC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine?
The IUPAC name of (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine (CID 105170368) is (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine.
What is the SMILES notation for (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine?
The canonical SMILES for (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine is NC(C1CCC(F)(F)CC1)C1CCOC2(CCOC2)C1.
What is the InChIKey of (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine?
The InChIKey is DFGWFRWRYMXGHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25F2NO2/c16-15(17)4-1-11(2-5-15)13(18)12-3-7-20-14(9-12)6-8-19-10-14/h11-13H,1-10,18H2.
What are the key properties of (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine?
(4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine has a molecular weight of 289.37 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl)-(2,6-dioxaspiro[4.5]decan-9-yl)methanamine is sourced from PubChem (CID 105170368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).