About 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane
2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane (PubChem CID 10517045) has the molecular formula C17H14S2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane.
Molecular Properties
| Compound Name | 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane |
| PubChem CID | 10517045 |
| Molecular Formula | C17H14S2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane |
| SMILES | C(#CC1(c2ccccc2)SCCS1)c1ccccc1 |
| InChI | InChI=1S/C17H14S2/c1-3-7-15(8-4-1)11-12-17(18-13-14-19-17)16-9-5-2-6-10-16/h1-10H,13-14H2 |
| InChIKey | CDWVGBIVBMWYTG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane?
The IUPAC name of 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane (CID 10517045) is 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane.
What is the SMILES notation for 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane?
The canonical SMILES for 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane is C(#CC1(c2ccccc2)SCCS1)c1ccccc1.
What is the InChIKey of 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane?
The InChIKey is CDWVGBIVBMWYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14S2/c1-3-7-15(8-4-1)11-12-17(18-13-14-19-17)16-9-5-2-6-10-16/h1-10H,13-14H2.
What are the key properties of 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane?
2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane has a molecular weight of 282.43 g/mol, XLogP of 4.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2-(2-phenylethynyl)-1,3-dithiolane is sourced from PubChem (CID 10517045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).