C14H23N3OS2 — CID 105170732
N-[6-oxa-2-thiaspiro[4.5]decan-9-yl(thiadiazol-5-yl)methyl]propan-1-amine (PubChem CID 105170732) has the molecular formula C14H23N3OS2 and a molecular weight of 313.49 g/mol. Its IUPAC name is N-[6-oxa-2-thiaspiro[4.5]decan-9-yl(thiadiazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[6-oxa-2-thiaspiro[4.5]decan-9-yl(thiadiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105170732 |
| Molecular Formula | C14H23N3OS2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[6-oxa-2-thiaspiro[4.5]decan-9-yl(thiadiazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cnns1)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C14H23N3OS2/c1-2-5-15-13(12-9-16-17-20-12)11-3-6-18-14(8-11)4-7-19-10-14/h9,11,13,15H,2-8,10H2,1H3 |
| InChIKey | PJFBYHKCXPRMQL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |