About N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine
N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine (PubChem CID 10517096) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine.
Molecular Properties
| Compound Name | N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine |
| PubChem CID | 10517096 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine |
| SMILES | CCN(O)CCc1ccc2c(c1)Cc1ccccc1CO2 |
| InChI | InChI=1S/C18H21NO2/c1-2-19(20)10-9-14-7-8-18-17(11-14)12-15-5-3-4-6-16(15)13-21-18/h3-8,11,20H,2,9-10,12-13H2,1H3 |
| InChIKey | GGTMKLIANRVFDW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine?
The IUPAC name of N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine (CID 10517096) is N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine.
What is the SMILES notation for N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine?
The canonical SMILES for N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine is CCN(O)CCc1ccc2c(c1)Cc1ccccc1CO2.
What is the InChIKey of N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine?
The InChIKey is GGTMKLIANRVFDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-2-19(20)10-9-14-7-8-18-17(11-14)12-15-5-3-4-6-16(15)13-21-18/h3-8,11,20H,2,9-10,12-13H2,1H3.
What are the key properties of N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine?
N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine has a molecular weight of 283.37 g/mol, XLogP of 3.42, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(6,11-dihydrobenzo[c][1]benzoxepin-2-yl)ethyl]-N-ethylhydroxylamine is sourced from PubChem (CID 10517096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).