About 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one
1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one (PubChem CID 10517210) has the molecular formula C17H20O2Si
and a molecular weight of 284.43 g/mol. Its IUPAC name is 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one.
Molecular Properties
| Compound Name | 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one |
| PubChem CID | 10517210 |
| Molecular Formula | C17H20O2Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one |
| SMILES | CC1=C(C)C12OC(=O)C([Si](C)(C)C)=C2c1ccccc1 |
| InChI | InChI=1S/C17H20O2Si/c1-11-12(2)17(11)14(13-9-7-6-8-10-13)15(16(18)19-17)20(3,4)5/h6-10H,1-5H3 |
| InChIKey | GFDKPMPCXDTRRG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one?
The IUPAC name of 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one (CID 10517210) is 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one.
What is the SMILES notation for 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one?
The canonical SMILES for 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one is CC1=C(C)C12OC(=O)C([Si](C)(C)C)=C2c1ccccc1.
What is the InChIKey of 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one?
The InChIKey is GFDKPMPCXDTRRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O2Si/c1-11-12(2)17(11)14(13-9-7-6-8-10-13)15(16(18)19-17)20(3,4)5/h6-10H,1-5H3.
What are the key properties of 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one?
1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one has a molecular weight of 284.43 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-7-phenyl-6-trimethylsilyl-4-oxaspiro[2.4]hepta-1,6-dien-5-one is sourced from PubChem (CID 10517210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).