C17H20O4 — CID 10517454
[(4aR,5R,6S)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate (PubChem CID 10517454) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is [(4aR,5R,6S)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate.
| Compound Name | [(4aR,5R,6S)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate |
|---|---|
| PubChem CID | 10517454 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [(4aR,5R,6S)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC=C2C=C3OC(=O)C(C)=C3C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C17H20O4/c1-9-13-8-17(4)10(2)14(20-11(3)18)6-5-12(17)7-15(13)21-16(9)19/h5,7,10,14H,6,8H2,1-4H3/t10-,14-,17+/m0/s1 |
| InChIKey | CPBGIOVSFPPFTD-RMLVOYDJSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |