C16H20N2O3 — CID 10517458
(1S,4R)-N-(4-aminophenyl)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 10517458) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (1S,4R)-N-(4-aminophenyl)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,4R)-N-(4-aminophenyl)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 10517458 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (1S,4R)-N-(4-aminophenyl)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)Nc1ccc(N)cc1)OC2=O |
| InChI | InChI=1S/C16H20N2O3/c1-14(2)15(3)8-9-16(14,21-13(15)20)12(19)18-11-6-4-10(17)5-7-11/h4-7H,8-9,17H2,1-3H3,(H,18,19)/t15-,16+/m0/s1 |
| InChIKey | NGCHQOGOMAWLCH-JKSUJKDBSA-N |
| XLogP | 2.33 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|