C10H12N4OS — CID 105175526
(5-ethoxy-3-pyridinyl)-(1,2,5-thiadiazol-3-yl)methanamine (PubChem CID 105175526) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is (5-ethoxy-3-pyridinyl)-(1,2,5-thiadiazol-3-yl)methanamine.
| Compound Name | (5-ethoxy-3-pyridinyl)-(1,2,5-thiadiazol-3-yl)methanamine |
|---|---|
| PubChem CID | 105175526 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (5-ethoxy-3-pyridinyl)-(1,2,5-thiadiazol-3-yl)methanamine |
| SMILES | CCOc1cncc(C(N)c2cnsn2)c1 |
| InChI | InChI=1S/C10H12N4OS/c1-2-15-8-3-7(4-12-5-8)10(11)9-6-13-16-14-9/h3-6,10H,2,11H2,1H3 |
| InChIKey | LYRULDNXERYKEU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |