C15H14O4S — CID 10517608
2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzoxathiine-5,7-diol (PubChem CID 10517608) has the molecular formula C15H14O4S and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzoxathiine-5,7-diol.
| Compound Name | 2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzoxathiine-5,7-diol |
|---|---|
| PubChem CID | 10517608 |
| Molecular Formula | C15H14O4S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-(4-methoxyphenyl)-2,3-dihydro-1,4-benzoxathiine-5,7-diol |
| SMILES | COc1ccc(C2CSc3c(O)cc(O)cc3O2)cc1 |
| InChI | InChI=1S/C15H14O4S/c1-18-11-4-2-9(3-5-11)14-8-20-15-12(17)6-10(16)7-13(15)19-14/h2-7,14,16-17H,8H2,1H3 |
| InChIKey | LAQWKGAAGZVOPG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |