C18H24O3 — CID 10517626
6-[(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-(dideuteriomethyl)-4-methoxypyran-2-one (PubChem CID 10517626) has the molecular formula C18H24O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 6-[(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-(dideuteriomethyl)-4-methoxypyran-2-one.
| Compound Name | 6-[(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-(dideuteriomethyl)-4-methoxypyran-2-one |
|---|---|
| PubChem CID | 10517626 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 6-[(1R,2R,4aS,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-(dideuteriomethyl)-4-methoxypyran-2-one |
| SMILES | [2H]C([2H])c1c(OC)cc([C@H]2[C@@H]3CCCC[C@H]3C=C[C@H]2C)oc1=O |
| InChI | InChI=1S/C18H24O3/c1-11-8-9-13-6-4-5-7-14(13)17(11)16-10-15(20-3)12(2)18(19)21-16/h8-11,13-14,17H,4-7H2,1-3H3/t11-,13+,14-,17-/m1/s1/i2D2 |
| InChIKey | JGKYBCKWFKUYJN-GWVHOTFISA-N |
| XLogP | 4.05 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|