C12H18FNOS — CID 105176598
1-(5-fluoro-2-methoxyphenyl)-N-methyl-3-methylsulfanylpropan-1-amine (PubChem CID 105176598) has the molecular formula C12H18FNOS and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxyphenyl)-N-methyl-3-methylsulfanylpropan-1-amine.
| Compound Name | 1-(5-fluoro-2-methoxyphenyl)-N-methyl-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 105176598 |
| Molecular Formula | C12H18FNOS |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 1-(5-fluoro-2-methoxyphenyl)-N-methyl-3-methylsulfanylpropan-1-amine |
| SMILES | CNC(CCSC)c1cc(F)ccc1OC |
| InChI | InChI=1S/C12H18FNOS/c1-14-11(6-7-16-3)10-8-9(13)4-5-12(10)15-2/h4-5,8,11,14H,6-7H2,1-3H3 |
| InChIKey | HSXAWSKMEBPDTD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |