C13H13F4NO2 — CID 10517665
(2E,4E)-5-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]penta-2,4-dien-1-ol (PubChem CID 10517665) has the molecular formula C13H13F4NO2 and a molecular weight of 291.24 g/mol. Its IUPAC name is (2E,4E)-5-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]penta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-5-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 10517665 |
| Molecular Formula | C13H13F4NO2 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (2E,4E)-5-[6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]penta-2,4-dien-1-ol |
| SMILES | OC/C=C/C=C/c1ccc(OCC(F)(F)C(F)F)nc1 |
| InChI | InChI=1S/C13H13F4NO2/c14-12(15)13(16,17)9-20-11-6-5-10(8-18-11)4-2-1-3-7-19/h1-6,8,12,19H,7,9H2/b3-1+,4-2+ |
| InChIKey | YFPLTORDXWTCKC-ZPUQHVIOSA-N |
| XLogP | 2.92 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|