C17H29NOSi — CID 10517713
dimethyl-phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)oxysilane (PubChem CID 10517713) has the molecular formula C17H29NOSi and a molecular weight of 291.51 g/mol. Its IUPAC name is dimethyl-phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)oxysilane.
| Compound Name | dimethyl-phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)oxysilane |
|---|---|
| PubChem CID | 10517713 |
| Molecular Formula | C17H29NOSi |
| Molecular Weight | 291.51 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | dimethyl-phenyl-(2,2,6,6-tetramethylpiperidin-1-yl)oxysilane |
| SMILES | CC1(C)CCCC(C)(C)N1O[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H29NOSi/c1-16(2)13-10-14-17(3,4)18(16)19-20(5,6)15-11-8-7-9-12-15/h7-9,11-12H,10,13-14H2,1-6H3 |
| InChIKey | VFHURXGYUJHIGU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|