About N-(9,10-dioxophenanthren-3-yl)butanamide
N-(9,10-dioxophenanthren-3-yl)butanamide (PubChem CID 10517813) has the molecular formula C18H15NO3
and a molecular weight of 293.32 g/mol. Its IUPAC name is N-(9,10-dioxophenanthren-3-yl)butanamide.
Molecular Properties
| Compound Name | N-(9,10-dioxophenanthren-3-yl)butanamide |
| PubChem CID | 10517813 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-(9,10-dioxophenanthren-3-yl)butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)-c1ccccc1C(=O)C2=O |
| InChI | InChI=1S/C18H15NO3/c1-2-5-16(20)19-11-8-9-14-15(10-11)12-6-3-4-7-13(12)17(21)18(14)22/h3-4,6-10H,2,5H2,1H3,(H,19,20) |
| InChIKey | XRHJCLBIDQJFKO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(9,10-dioxophenanthren-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9,10-dioxophenanthren-3-yl)butanamide?
The IUPAC name of N-(9,10-dioxophenanthren-3-yl)butanamide (CID 10517813) is N-(9,10-dioxophenanthren-3-yl)butanamide.
What is the SMILES notation for N-(9,10-dioxophenanthren-3-yl)butanamide?
The canonical SMILES for N-(9,10-dioxophenanthren-3-yl)butanamide is CCCC(=O)Nc1ccc2c(c1)-c1ccccc1C(=O)C2=O.
What is the InChIKey of N-(9,10-dioxophenanthren-3-yl)butanamide?
The InChIKey is XRHJCLBIDQJFKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO3/c1-2-5-16(20)19-11-8-9-14-15(10-11)12-6-3-4-7-13(12)17(21)18(14)22/h3-4,6-10H,2,5H2,1H3,(H,19,20).
What are the key properties of N-(9,10-dioxophenanthren-3-yl)butanamide?
N-(9,10-dioxophenanthren-3-yl)butanamide has a molecular weight of 293.32 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9,10-dioxophenanthren-3-yl)butanamide is sourced from PubChem (CID 10517813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).