About (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine
(4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine (PubChem CID 105178307) has the molecular formula C13H19F2N3O2
and a molecular weight of 287.31 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine |
| PubChem CID | 105178307 |
| Molecular Formula | C13H19F2N3O2 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine |
| SMILES | COc1cnc(C(N)C2CCC(F)(F)CC2)c(OC)n1 |
| InChI | InChI=1S/C13H19F2N3O2/c1-19-9-7-17-11(12(18-9)20-2)10(16)8-3-5-13(14,15)6-4-8/h7-8,10H,3-6,16H2,1-2H3 |
| InChIKey | WVEZKMMRMLCQET-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine?
The IUPAC name of (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine (CID 105178307) is (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine.
What is the SMILES notation for (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine?
The canonical SMILES for (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine is COc1cnc(C(N)C2CCC(F)(F)CC2)c(OC)n1.
What is the InChIKey of (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine?
The InChIKey is WVEZKMMRMLCQET-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2N3O2/c1-19-9-7-17-11(12(18-9)20-2)10(16)8-3-5-13(14,15)6-4-8/h7-8,10H,3-6,16H2,1-2H3.
What are the key properties of (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine?
(4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine has a molecular weight of 287.31 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl)-(3,5-dimethoxypyrazin-2-yl)methanamine is sourced from PubChem (CID 105178307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).