C13H14F4OS — CID 10517872
2-[butylsulfanyl(difluoro)methyl]-2-(2,4-difluorophenyl)oxirane (PubChem CID 10517872) has the molecular formula C13H14F4OS and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[butylsulfanyl(difluoro)methyl]-2-(2,4-difluorophenyl)oxirane.
| Compound Name | 2-[butylsulfanyl(difluoro)methyl]-2-(2,4-difluorophenyl)oxirane |
|---|---|
| PubChem CID | 10517872 |
| Molecular Formula | C13H14F4OS |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[butylsulfanyl(difluoro)methyl]-2-(2,4-difluorophenyl)oxirane |
| SMILES | CCCCSC(F)(F)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C13H14F4OS/c1-2-3-6-19-13(16,17)12(8-18-12)10-5-4-9(14)7-11(10)15/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | LZRBIVGWUPFSMD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|