C13H13ClFN3 — CID 105178948
2-(2-chloro-3-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethanamine (PubChem CID 105178948) has the molecular formula C13H13ClFN3 and a molecular weight of 265.72 g/mol. Its IUPAC name is 2-(2-chloro-3-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethanamine.
| Compound Name | 2-(2-chloro-3-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethanamine |
|---|---|
| PubChem CID | 105178948 |
| Molecular Formula | C13H13ClFN3 |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-(2-chloro-3-fluorophenyl)-1-(5-methylpyrazin-2-yl)ethanamine |
| SMILES | Cc1cnc(C(N)Cc2cccc(F)c2Cl)cn1 |
| InChI | InChI=1S/C13H13ClFN3/c1-8-6-18-12(7-17-8)11(16)5-9-3-2-4-10(15)13(9)14/h2-4,6-7,11H,5,16H2,1H3 |
| InChIKey | WYNXFXBZWLHKHG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |