C10H19NO2 — CID 105179423
1-(3,4-dihydro-2H-pyran-5-yl)-3-ethoxypropan-1-amine (PubChem CID 105179423) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-5-yl)-3-ethoxypropan-1-amine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-5-yl)-3-ethoxypropan-1-amine |
|---|---|
| PubChem CID | 105179423 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-5-yl)-3-ethoxypropan-1-amine |
| SMILES | CCOCCC(N)C1=COCCC1 |
| InChI | InChI=1S/C10H19NO2/c1-2-12-7-5-10(11)9-4-3-6-13-8-9/h8,10H,2-7,11H2,1H3 |
| InChIKey | PXDYEIZSMFGIEO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|