C13H16N2O6 — CID 10518008
N-[(E)-[(3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-ylidene]amino]benzamide (PubChem CID 10518008) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is N-[(E)-[(3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-ylidene]amino]benzamide.
| Compound Name | N-[(E)-[(3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 10518008 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-[(E)-[(3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-ylidene]amino]benzamide |
| SMILES | O=C(N/N=C1/O[C@@H]([C@H](O)CO)[C@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C13H16N2O6/c16-6-8(17)11-9(18)10(19)13(21-11)15-14-12(20)7-4-2-1-3-5-7/h1-5,8-11,16-19H,6H2,(H,14,20)/b15-13+/t8-,9-,10-,11+/m1/s1 |
| InChIKey | JPWHBKLMPUGZPN-HXONXNIPSA-N |
| XLogP | -1.80 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|