C16H24O5 — CID 10518042
5-[2-(cyclopenten-1-yl)-2-(methoxymethoxy)ethyl]-2,2,6-trimethyl-1,3-dioxin-4-one (PubChem CID 10518042) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 5-[2-(cyclopenten-1-yl)-2-(methoxymethoxy)ethyl]-2,2,6-trimethyl-1,3-dioxin-4-one.
| Compound Name | 5-[2-(cyclopenten-1-yl)-2-(methoxymethoxy)ethyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10518042 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 5-[2-(cyclopenten-1-yl)-2-(methoxymethoxy)ethyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
| SMILES | COCOC(CC1=C(C)OC(C)(C)OC1=O)C1=CCCC1 |
| InChI | InChI=1S/C16H24O5/c1-11-13(15(17)21-16(2,3)20-11)9-14(19-10-18-4)12-7-5-6-8-12/h7,14H,5-6,8-10H2,1-4H3 |
| InChIKey | HQNTVWHLSXQSTD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|