C11H12FN3OS — CID 105180643
2-(2-fluoro-3-methoxyphenyl)-1-(thiadiazol-5-yl)ethanamine (PubChem CID 105180643) has the molecular formula C11H12FN3OS and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(2-fluoro-3-methoxyphenyl)-1-(thiadiazol-5-yl)ethanamine.
| Compound Name | 2-(2-fluoro-3-methoxyphenyl)-1-(thiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105180643 |
| Molecular Formula | C11H12FN3OS |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-(2-fluoro-3-methoxyphenyl)-1-(thiadiazol-5-yl)ethanamine |
| SMILES | COc1cccc(CC(N)c2cnns2)c1F |
| InChI | InChI=1S/C11H12FN3OS/c1-16-9-4-2-3-7(11(9)12)5-8(13)10-6-14-15-17-10/h2-4,6,8H,5,13H2,1H3 |
| InChIKey | DXGZMQCVEZTTLV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |