C12H15BrN4S — CID 105180886
2-(5-bromo-2-pyridinyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine (PubChem CID 105180886) has the molecular formula C12H15BrN4S and a molecular weight of 327.25 g/mol. Its IUPAC name is 2-(5-bromo-2-pyridinyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(5-bromo-2-pyridinyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105180886 |
| Molecular Formula | C12H15BrN4S |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-(5-bromo-2-pyridinyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
| SMILES | CC(C)c1nnsc1C(N)Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H15BrN4S/c1-7(2)11-12(18-17-16-11)10(14)5-9-4-3-8(13)6-15-9/h3-4,6-7,10H,5,14H2,1-2H3 |
| InChIKey | CPSGZQKAQVFMMR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |