C13H15FN4 — CID 105181955
N-[(3-fluoro-4-pyridinyl)-pyridazin-4-ylmethyl]propan-1-amine (PubChem CID 105181955) has the molecular formula C13H15FN4 and a molecular weight of 246.29 g/mol. Its IUPAC name is N-[(3-fluoro-4-pyridinyl)-pyridazin-4-ylmethyl]propan-1-amine.
| Compound Name | N-[(3-fluoro-4-pyridinyl)-pyridazin-4-ylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 105181955 |
| Molecular Formula | C13H15FN4 |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | N-[(3-fluoro-4-pyridinyl)-pyridazin-4-ylmethyl]propan-1-amine |
| SMILES | CCCNC(c1ccnnc1)c1ccncc1F |
| InChI | InChI=1S/C13H15FN4/c1-2-5-16-13(10-3-7-17-18-8-10)11-4-6-15-9-12(11)14/h3-4,6-9,13,16H,2,5H2,1H3 |
| InChIKey | XOGSJIPLVIBSSY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |