C16H30O3Si — CID 10518214
prop-2-enyl (E,2S,3R)-3-hydroxy-2-[(1R)-2-methyl-1-trimethylsilylpropyl]hex-4-enoate (PubChem CID 10518214) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is prop-2-enyl (E,2S,3R)-3-hydroxy-2-[(1R)-2-methyl-1-trimethylsilylpropyl]hex-4-enoate.
| Compound Name | prop-2-enyl (E,2S,3R)-3-hydroxy-2-[(1R)-2-methyl-1-trimethylsilylpropyl]hex-4-enoate |
|---|---|
| PubChem CID | 10518214 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | prop-2-enyl (E,2S,3R)-3-hydroxy-2-[(1R)-2-methyl-1-trimethylsilylpropyl]hex-4-enoate |
| SMILES | C=CCOC(=O)[C@H]([C@H](O)/C=C/C)[C@@H](C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-8-10-13(17)14(16(18)19-11-9-2)15(12(3)4)20(5,6)7/h8-10,12-15,17H,2,11H2,1,3-7H3/b10-8+/t13-,14-,15-/m1/s1 |
| InChIKey | QVRGZUTVIMCWKK-ICFHNOQGSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|