C16H30O3Si — CID 10518215
[(1R,4S)-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] acetate (PubChem CID 10518215) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is [(1R,4S)-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] acetate.
| Compound Name | [(1R,4S)-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10518215 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [(1R,4S)-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](CO[Si](C)(C)C(C)(C)C(C)C)C1 |
| InChI | InChI=1S/C16H30O3Si/c1-12(2)16(4,5)20(6,7)18-11-14-8-9-15(10-14)19-13(3)17/h8-9,12,14-15H,10-11H2,1-7H3/t14-,15+/m1/s1 |
| InChIKey | GVZFWCQZGRGSHQ-CABCVRRESA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|