C11H14BrN5 — CID 105183012
1-(4-bromo-1-ethylpyrazol-5-yl)-N-methyl-1-pyridazin-4-ylmethanamine (PubChem CID 105183012) has the molecular formula C11H14BrN5 and a molecular weight of 296.17 g/mol. Its IUPAC name is 1-(4-bromo-1-ethylpyrazol-5-yl)-N-methyl-1-pyridazin-4-ylmethanamine.
| Compound Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-N-methyl-1-pyridazin-4-ylmethanamine |
|---|---|
| PubChem CID | 105183012 |
| Molecular Formula | C11H14BrN5 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-N-methyl-1-pyridazin-4-ylmethanamine |
| SMILES | CCn1ncc(Br)c1C(NC)c1ccnnc1 |
| InChI | InChI=1S/C11H14BrN5/c1-3-17-11(9(12)7-16-17)10(13-2)8-4-5-14-15-6-8/h4-7,10,13H,3H2,1-2H3 |
| InChIKey | MWWBZQRBGVBZBZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |