C16H15NO3S — CID 10518397
2-(2-acetylanilino)-5-ethylsulfanylcyclohexa-2,5-diene-1,4-dione (PubChem CID 10518397) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-(2-acetylanilino)-5-ethylsulfanylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(2-acetylanilino)-5-ethylsulfanylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10518397 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-(2-acetylanilino)-5-ethylsulfanylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCSC1=CC(=O)C(Nc2ccccc2C(C)=O)=CC1=O |
| InChI | InChI=1S/C16H15NO3S/c1-3-21-16-9-14(19)13(8-15(16)20)17-12-7-5-4-6-11(12)10(2)18/h4-9,17H,3H2,1-2H3 |
| InChIKey | DEIPKSSUKJYKEZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|