C16H23ClN4 — CID 105184165
1-(4-chloro-1-propylpyrazol-5-yl)-N-ethyl-3-pyridin-3-ylpropan-1-amine (PubChem CID 105184165) has the molecular formula C16H23ClN4 and a molecular weight of 306.84 g/mol. Its IUPAC name is 1-(4-chloro-1-propylpyrazol-5-yl)-N-ethyl-3-pyridin-3-ylpropan-1-amine.
| Compound Name | 1-(4-chloro-1-propylpyrazol-5-yl)-N-ethyl-3-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 105184165 |
| Molecular Formula | C16H23ClN4 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-(4-chloro-1-propylpyrazol-5-yl)-N-ethyl-3-pyridin-3-ylpropan-1-amine |
| SMILES | CCCn1ncc(Cl)c1C(CCc1cccnc1)NCC |
| InChI | InChI=1S/C16H23ClN4/c1-3-10-21-16(14(17)12-20-21)15(19-4-2)8-7-13-6-5-9-18-11-13/h5-6,9,11-12,15,19H,3-4,7-8,10H2,1-2H3 |
| InChIKey | PDZQRHZGTYGIKY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |