C24H23N3O3S — CID 1051845
2-[[(1R)-1-benzamido-2-oxo-2-phenylethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 1051845) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-[[(1R)-1-benzamido-2-oxo-2-phenylethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[(1R)-1-benzamido-2-oxo-2-phenylethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 1051845 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-[[(1R)-1-benzamido-2-oxo-2-phenylethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(N[C@@H](NC(=O)c2ccccc2)C(=O)c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C24H23N3O3S/c25-21(29)19-17-13-7-8-14-18(17)31-24(19)27-22(20(28)15-9-3-1-4-10-15)26-23(30)16-11-5-2-6-12-16/h1-6,9-12,22,27H,7-8,13-14H2,(H2,25,29)(H,26,30)/t22-/m1/s1 |
| InChIKey | AYXKYOGNILIAPP-JOCHJYFZSA-N |
| XLogP | 3.78 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|