C15H21F3OSi — CID 10518480
trimethyl-[[(1R,2S,3R,4S,8S)-4-(trifluoromethyl)-3-tetracyclo[6.3.0.02,4.03,7]undec-5-enyl]oxy]silane (PubChem CID 10518480) has the molecular formula C15H21F3OSi and a molecular weight of 302.41 g/mol. Its IUPAC name is trimethyl-[[(1R,2S,3R,4S,8S)-4-(trifluoromethyl)-3-tetracyclo[6.3.0.02,4.03,7]undec-5-enyl]oxy]silane.
| Compound Name | trimethyl-[[(1R,2S,3R,4S,8S)-4-(trifluoromethyl)-3-tetracyclo[6.3.0.02,4.03,7]undec-5-enyl]oxy]silane |
|---|---|
| PubChem CID | 10518480 |
| Molecular Formula | C15H21F3OSi |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | trimethyl-[[(1R,2S,3R,4S,8S)-4-(trifluoromethyl)-3-tetracyclo[6.3.0.02,4.03,7]undec-5-enyl]oxy]silane |
| SMILES | C[Si](C)(C)O[C@@]12C3C=C[C@]1(C(F)(F)F)[C@@H]2[C@@H]1CCC[C@H]31 |
| InChI | InChI=1S/C15H21F3OSi/c1-20(2,3)19-14-11-7-8-13(14,15(16,17)18)12(14)10-6-4-5-9(10)11/h7-12H,4-6H2,1-3H3/t9-,10+,11?,12-,13-,14+/m0/s1 |
| InChIKey | YTUGCEFMSRTPBF-RGBPBDRFSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|