C13H20O6S — CID 10518612
[(3aR,5S,6R,6aR)-5-[(1S)-1-acetylsulfanylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate (PubChem CID 10518612) has the molecular formula C13H20O6S and a molecular weight of 304.36 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-5-[(1S)-1-acetylsulfanylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,5S,6R,6aR)-5-[(1S)-1-acetylsulfanylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 10518612 |
| Molecular Formula | C13H20O6S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [(3aR,5S,6R,6aR)-5-[(1S)-1-acetylsulfanylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H](C)SC(C)=O |
| InChI | InChI=1S/C13H20O6S/c1-6(20-8(3)15)9-10(16-7(2)14)11-12(17-9)19-13(4,5)18-11/h6,9-12H,1-5H3/t6-,9+,10-,11+,12+/m0/s1 |
| InChIKey | FMCQXCJZHQCTMR-MWAPLWLCSA-N |
| XLogP | 1.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|