C20H32O2 — CID 10518634
(1R,2R,3S,5S,8R)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5-diol (PubChem CID 10518634) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,2R,3S,5S,8R)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5-diol.
| Compound Name | (1R,2R,3S,5S,8R)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5-diol |
|---|---|
| PubChem CID | 10518634 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,2R,3S,5S,8R)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5-diol |
| SMILES | C=C1[C@@H](O)CC[C@@]2(C)CCC3=C(C)CC[C@@H]([C@@H](O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C20H32O2/c1-12-6-7-15-18(22)17-13(2)16(21)9-11-20(17,5)10-8-14(12)19(15,3)4/h15-18,21-22H,2,6-11H2,1,3-5H3/t15-,16-,17-,18+,20+/m0/s1 |
| InChIKey | QDSRNVITOJPOJZ-KVIJGQROSA-N |
| XLogP | 4.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|