C15H13BrO2 — CID 10518650
(1S,12R)-11-bromo-3-oxatetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,13-tetraen-10-one (PubChem CID 10518650) has the molecular formula C15H13BrO2 and a molecular weight of 305.17 g/mol. Its IUPAC name is (1S,12R)-11-bromo-3-oxatetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,13-tetraen-10-one.
| Compound Name | (1S,12R)-11-bromo-3-oxatetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,13-tetraen-10-one |
|---|---|
| PubChem CID | 10518650 |
| Molecular Formula | C15H13BrO2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | (1S,12R)-11-bromo-3-oxatetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,13-tetraen-10-one |
| SMILES | O=C1c2ccccc2OC2[C@@H]3C=C[C@@H](CC3)C12Br |
| InChI | InChI=1S/C15H13BrO2/c16-15-10-7-5-9(6-8-10)14(15)18-12-4-2-1-3-11(12)13(15)17/h1-5,7,9-10,14H,6,8H2/t9-,10+,14?,15?/m1/s1 |
| InChIKey | VZAJMGBJVRUJKE-YAGSZDGKSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|