C13H21N5OS — CID 105186690
1-(1-ethyl-4-methoxypyrazol-5-yl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)methanamine (PubChem CID 105186690) has the molecular formula C13H21N5OS and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-(1-ethyl-4-methoxypyrazol-5-yl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)methanamine.
| Compound Name | 1-(1-ethyl-4-methoxypyrazol-5-yl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 105186690 |
| Molecular Formula | C13H21N5OS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-(1-ethyl-4-methoxypyrazol-5-yl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)methanamine |
| SMILES | CCn1ncc(OC)c1C(NC)c1snnc1C(C)C |
| InChI | InChI=1S/C13H21N5OS/c1-6-18-12(9(19-5)7-15-18)11(14-4)13-10(8(2)3)16-17-20-13/h7-8,11,14H,6H2,1-5H3 |
| InChIKey | UJTGVOPSINSBLN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |