C15H22N4O2 — CID 105187148
1-(4-methoxy-1-propylpyrazol-5-yl)-1-(2-methoxy-3-pyridinyl)-N-methylmethanamine (PubChem CID 105187148) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-(4-methoxy-1-propylpyrazol-5-yl)-1-(2-methoxy-3-pyridinyl)-N-methylmethanamine.
| Compound Name | 1-(4-methoxy-1-propylpyrazol-5-yl)-1-(2-methoxy-3-pyridinyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105187148 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-(4-methoxy-1-propylpyrazol-5-yl)-1-(2-methoxy-3-pyridinyl)-N-methylmethanamine |
| SMILES | CCCn1ncc(OC)c1C(NC)c1cccnc1OC |
| InChI | InChI=1S/C15H22N4O2/c1-5-9-19-14(12(20-3)10-18-19)13(16-2)11-7-6-8-17-15(11)21-4/h6-8,10,13,16H,5,9H2,1-4H3 |
| InChIKey | YMQLRMWNIIUVET-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |