About (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate
(5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate (PubChem CID 10518718) has the molecular formula C15H18N2O5
and a molecular weight of 306.32 g/mol. Its IUPAC name is (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate.
Molecular Properties
| Compound Name | (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate |
| PubChem CID | 10518718 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate |
| SMILES | COC1=CC(=O)c2c(c(COC(N)=O)c(C(C)C)n2C)C1=O |
| InChI | InChI=1S/C15H18N2O5/c1-7(2)12-8(6-22-15(16)20)11-13(17(12)3)9(18)5-10(21-4)14(11)19/h5,7H,6H2,1-4H3,(H2,16,20) |
| InChIKey | WRANDDDLZFGJDA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate?
The IUPAC name of (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate (CID 10518718) is (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate.
What is the SMILES notation for (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate?
The canonical SMILES for (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate is COC1=CC(=O)c2c(c(COC(N)=O)c(C(C)C)n2C)C1=O.
What is the InChIKey of (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate?
The InChIKey is WRANDDDLZFGJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O5/c1-7(2)12-8(6-22-15(16)20)11-13(17(12)3)9(18)5-10(21-4)14(11)19/h5,7H,6H2,1-4H3,(H2,16,20).
What are the key properties of (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate?
(5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate has a molecular weight of 306.32 g/mol, XLogP of 1.65, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxy-1-methyl-4,7-dioxo-2-propan-2-ylindol-3-yl)methyl carbamate is sourced from PubChem (CID 10518718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).