C15H17N5 — CID 105187594
3-(1-methylimidazol-2-yl)-1-quinoxalin-5-ylpropan-1-amine (PubChem CID 105187594) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 3-(1-methylimidazol-2-yl)-1-quinoxalin-5-ylpropan-1-amine.
| Compound Name | 3-(1-methylimidazol-2-yl)-1-quinoxalin-5-ylpropan-1-amine |
|---|---|
| PubChem CID | 105187594 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-(1-methylimidazol-2-yl)-1-quinoxalin-5-ylpropan-1-amine |
| SMILES | Cn1ccnc1CCC(N)c1cccc2nccnc12 |
| InChI | InChI=1S/C15H17N5/c1-20-10-9-18-14(20)6-5-12(16)11-3-2-4-13-15(11)19-8-7-17-13/h2-4,7-10,12H,5-6,16H2,1H3 |
| InChIKey | SEGKMINGPDTUDS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |