C17H24FNO3 — CID 10518946
N-[(E,2S,3R)-5-(4-fluorophenyl)-1,3-dihydroxypent-4-en-2-yl]hexanamide (PubChem CID 10518946) has the molecular formula C17H24FNO3 and a molecular weight of 309.40 g/mol. Its IUPAC name is N-[(E,2S,3R)-5-(4-fluorophenyl)-1,3-dihydroxypent-4-en-2-yl]hexanamide.
| Compound Name | N-[(E,2S,3R)-5-(4-fluorophenyl)-1,3-dihydroxypent-4-en-2-yl]hexanamide |
|---|---|
| PubChem CID | 10518946 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-[(E,2S,3R)-5-(4-fluorophenyl)-1,3-dihydroxypent-4-en-2-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@@H](CO)[C@@H](/C=C/C1=CC=C(C=C1)F)O |
| InChI | InChI=1S/C17H24FNO3/c1-2-3-4-5-17(22)19-15(12-20)16(21)11-8-13-6-9-14(18)10-7-13/h6-11,15-16,20-21H,2-5,12H2,1H3,(H,19,22)/b11-8+/t15-,16+/m0/s1 |
| InChIKey | TXXPRKZRLBTMMB-UGTRGGQESA-N |
| XLogP | 2.40 |
| TPSA | 69.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | 341 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|