C19H29NS — CID 105189636
N-[(3-cyclobutylphenyl)-(2-methylthiolan-2-yl)methyl]propan-1-amine (PubChem CID 105189636) has the molecular formula C19H29NS and a molecular weight of 303.52 g/mol. Its IUPAC name is N-[(3-cyclobutylphenyl)-(2-methylthiolan-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-cyclobutylphenyl)-(2-methylthiolan-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105189636 |
| Molecular Formula | C19H29NS |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | N-[(3-cyclobutylphenyl)-(2-methylthiolan-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cccc(C2CCC2)c1)C1(C)CCCS1 |
| InChI | InChI=1S/C19H29NS/c1-3-12-20-18(19(2)11-6-13-21-19)17-10-5-9-16(14-17)15-7-4-8-15/h5,9-10,14-15,18,20H,3-4,6-8,11-13H2,1-2H3 |
| InChIKey | TUCRNSMXGCJCBA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |