C14H18N2OS — CID 105191453
[1-(3-methylthiophen-2-yl)-3-phenoxypropyl]hydrazine (PubChem CID 105191453) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is [1-(3-methylthiophen-2-yl)-3-phenoxypropyl]hydrazine.
| Compound Name | [1-(3-methylthiophen-2-yl)-3-phenoxypropyl]hydrazine |
|---|---|
| PubChem CID | 105191453 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | [1-(3-methylthiophen-2-yl)-3-phenoxypropyl]hydrazine |
| SMILES | Cc1ccsc1C(CCOc1ccccc1)NN |
| InChI | InChI=1S/C14H18N2OS/c1-11-8-10-18-14(11)13(16-15)7-9-17-12-5-3-2-4-6-12/h2-6,8,10,13,16H,7,9,15H2,1H3 |
| InChIKey | LYIZSXYXGGNIDA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|