C12H20N2O2 — CID 105191587
[1-(3-methoxyphenyl)-2-propoxyethyl]hydrazine (PubChem CID 105191587) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is [1-(3-methoxyphenyl)-2-propoxyethyl]hydrazine.
| Compound Name | [1-(3-methoxyphenyl)-2-propoxyethyl]hydrazine |
|---|---|
| PubChem CID | 105191587 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | [1-(3-methoxyphenyl)-2-propoxyethyl]hydrazine |
| SMILES | CCCOCC(NN)c1cccc(OC)c1 |
| InChI | InChI=1S/C12H20N2O2/c1-3-7-16-9-12(14-13)10-5-4-6-11(8-10)15-2/h4-6,8,12,14H,3,7,9,13H2,1-2H3 |
| InChIKey | DJSMMLIIRCZQKC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|