C13H20N2 — CID 105194324
[4-methyl-1-(4-methylphenyl)pent-4-enyl]hydrazine (PubChem CID 105194324) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is [4-methyl-1-(4-methylphenyl)pent-4-enyl]hydrazine.
| Compound Name | [4-methyl-1-(4-methylphenyl)pent-4-enyl]hydrazine |
|---|---|
| PubChem CID | 105194324 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | [4-methyl-1-(4-methylphenyl)pent-4-enyl]hydrazine |
| SMILES | C=C(C)CCC(NN)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H20N2/c1-10(2)4-9-13(15-14)12-7-5-11(3)6-8-12/h5-8,13,15H,1,4,9,14H2,2-3H3 |
| InChIKey | MVFWWPLUDUYHFK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|