About 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine
6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine (PubChem CID 10519453) has the molecular formula C18H18ClNO2
and a molecular weight of 315.80 g/mol. Its IUPAC name is 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine.
Molecular Properties
| Compound Name | 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine |
| PubChem CID | 10519453 |
| Molecular Formula | C18H18ClNO2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine |
| SMILES | COc1ccc2c(c1)Oc1ccccc1N=C2CCCCCl |
| InChI | InChI=1S/C18H18ClNO2/c1-21-13-9-10-14-15(6-4-5-11-19)20-16-7-2-3-8-17(16)22-18(14)12-13/h2-3,7-10,12H,4-6,11H2,1H3 |
| InChIKey | RHEYALDTLYULRE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine?
The IUPAC name of 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine (CID 10519453) is 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine.
What is the SMILES notation for 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine?
The canonical SMILES for 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine is COc1ccc2c(c1)Oc1ccccc1N=C2CCCCCl.
What is the InChIKey of 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine?
The InChIKey is RHEYALDTLYULRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClNO2/c1-21-13-9-10-14-15(6-4-5-11-19)20-16-7-2-3-8-17(16)22-18(14)12-13/h2-3,7-10,12H,4-6,11H2,1H3.
What are the key properties of 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine?
6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine has a molecular weight of 315.80 g/mol, XLogP of 5.33, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorobutyl)-9-methoxybenzo[b][1,4]benzoxazepine is sourced from PubChem (CID 10519453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).