C15H24O5S — CID 10519493
(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(prop-2-enylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 10519493) has the molecular formula C15H24O5S and a molecular weight of 316.42 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(prop-2-enylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(prop-2-enylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 10519493 |
| Molecular Formula | C15H24O5S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(prop-2-enylsulfanylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | C=CCSC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C15H24O5S/c1-6-7-21-8-9-10-11(18-14(2,3)17-10)12-13(16-9)20-15(4,5)19-12/h6,9-13H,1,7-8H2,2-5H3/t9-,10+,11+,12-,13-/m1/s1 |
| InChIKey | VZTJKDIFNKGRQE-KSSYENDESA-N |
| XLogP | 2.30 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|