About 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile
4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile (PubChem CID 10519534) has the molecular formula C19H15N3O2
and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile |
| PubChem CID | 10519534 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile |
| SMILES | C[C@@H](Nc1c(Nc2ccc(C#N)cc2)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C19H15N3O2/c1-12(14-5-3-2-4-6-14)21-16-17(19(24)18(16)23)22-15-9-7-13(11-20)8-10-15/h2-10,12,21-22H,1H3/t12-/m1/s1 |
| InChIKey | QMQQLTGPBDNOMN-GFCCVEGCSA-N |
| XLogP | 3.07 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile?
The IUPAC name of 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile (CID 10519534) is 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile.
What is the SMILES notation for 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile?
The canonical SMILES for 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile is C[C@@H](Nc1c(Nc2ccc(C#N)cc2)c(=O)c1=O)c1ccccc1.
What is the InChIKey of 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile?
The InChIKey is QMQQLTGPBDNOMN-GFCCVEGCSA-N. The full InChI is InChI=1S/C19H15N3O2/c1-12(14-5-3-2-4-6-14)21-16-17(19(24)18(16)23)22-15-9-7-13(11-20)8-10-15/h2-10,12,21-22H,1H3/t12-/m1/s1.
What are the key properties of 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile?
4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile has a molecular weight of 317.35 g/mol, XLogP of 3.07, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]benzonitrile is sourced from PubChem (CID 10519534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).