C21H34O2 — CID 10519627
2-pentadecylcyclohexa-2,5-diene-1,4-dione (PubChem CID 10519627) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 2-pentadecylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-pentadecylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10519627 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 2-pentadecylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCCCCCCCCCCC1=CC(=O)C=CC1=O |
| InChI | InChI=1S/C21H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-18-20(22)16-17-21(19)23/h16-18H,2-15H2,1H3 |
| InChIKey | LSWQTJBEJKTFHQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|