C21H38N2 — CID 10519632
N'-[(12Z)-heptadeca-12,16-dien-10-ynyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 10519632) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is N'-[(12Z)-heptadeca-12,16-dien-10-ynyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(12Z)-heptadeca-12,16-dien-10-ynyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 10519632 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | N'-[(12Z)-heptadeca-12,16-dien-10-ynyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=CCC/C=C\C#CCCCCCCCCCN(C)CCNC |
| InChI | InChI=1S/C21H38N2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(3)21-19-22-2/h4,7-8,22H,1,5-6,11-21H2,2-3H3/b8-7- |
| InChIKey | PRWVCICUUGWJMV-FPLPWBNLSA-N |
| XLogP | 4.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|