C13H18ClN5 — CID 105196368
[2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-pyridin-4-ylethyl]hydrazine (PubChem CID 105196368) has the molecular formula C13H18ClN5 and a molecular weight of 279.77 g/mol. Its IUPAC name is [2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-pyridin-4-ylethyl]hydrazine.
| Compound Name | [2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-pyridin-4-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105196368 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | [2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-pyridin-4-ylethyl]hydrazine |
| SMILES | CCn1nc(C)c(Cl)c1CC(NN)c1ccncc1 |
| InChI | InChI=1S/C13H18ClN5/c1-3-19-12(13(14)9(2)18-19)8-11(17-15)10-4-6-16-7-5-10/h4-7,11,17H,3,8,15H2,1-2H3 |
| InChIKey | QDNFQUXCGYIZKF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|