C15H27ClO3Si — CID 10519641
(3R,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-chloroethyl)-4-ethenyloxolan-2-one (PubChem CID 10519641) has the molecular formula C15H27ClO3Si and a molecular weight of 318.92 g/mol. Its IUPAC name is (3R,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-chloroethyl)-4-ethenyloxolan-2-one.
| Compound Name | (3R,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-chloroethyl)-4-ethenyloxolan-2-one |
|---|---|
| PubChem CID | 10519641 |
| Molecular Formula | C15H27ClO3Si |
| Molecular Weight | 318.92 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (3R,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-chloroethyl)-4-ethenyloxolan-2-one |
| SMILES | C=C[C@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)OC(=O)[C@@H]1CCCl |
| InChI | InChI=1S/C15H27ClO3Si/c1-7-11-12(8-9-16)14(17)19-13(11)10-18-20(5,6)15(2,3)4/h7,11-13H,1,8-10H2,2-6H3/t11-,12-,13-/m1/s1 |
| InChIKey | OPUYOFMHSZZUDK-JHJVBQTASA-N |
| XLogP | 3.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.92 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|