C12H11F2N3 — CID 105196411
[(2,6-difluorophenyl)-pyridin-4-ylmethyl]hydrazine (PubChem CID 105196411) has the molecular formula C12H11F2N3 and a molecular weight of 235.24 g/mol. Its IUPAC name is [(2,6-difluorophenyl)-pyridin-4-ylmethyl]hydrazine.
| Compound Name | [(2,6-difluorophenyl)-pyridin-4-ylmethyl]hydrazine |
|---|---|
| PubChem CID | 105196411 |
| Molecular Formula | C12H11F2N3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | [(2,6-difluorophenyl)-pyridin-4-ylmethyl]hydrazine |
| SMILES | NNC(c1ccncc1)c1c(F)cccc1F |
| InChI | InChI=1S/C12H11F2N3/c13-9-2-1-3-10(14)11(9)12(17-15)8-4-6-16-7-5-8/h1-7,12,17H,15H2 |
| InChIKey | DZOINJNJJYGQRV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|